C27H36N2O5 — CID 167160667
7-[4-[[(4S)-4-[2-(propylamino)ethoxy]-3,4-dihydro-2H-chromen-6-yl]oxy]butoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 167160667) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is 7-[4-[[(4S)-4-[2-(propylamino)ethoxy]-3,4-dihydro-2H-chromen-6-yl]oxy]butoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[4-[[(4S)-4-[2-(propylamino)ethoxy]-3,4-dihydro-2H-chromen-6-yl]oxy]butoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 167160667 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 7-[4-[[(4S)-4-[2-(propylamino)ethoxy]-3,4-dihydro-2H-chromen-6-yl]oxy]butoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCCNCCO[C@H]1CCOc2ccc(OCCCCOc3ccc4c(c3)NC(=O)CC4)cc21 |
| InChI | InChI=1S/C27H36N2O5/c1-2-12-28-13-17-34-26-11-16-33-25-9-8-21(18-23(25)26)31-14-3-4-15-32-22-7-5-20-6-10-27(30)29-24(20)19-22/h5,7-9,18-19,26,28H,2-4,6,10-17H2,1H3,(H,29,30)/t26-/m0/s1 |
| InChIKey | NDPXMGGFXIJOTG-SANMLTNESA-N |
| XLogP | 4.65 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|