About 2-[bis(2-methylpropyl)alumanyloxy]-N,N-dimethylethanamine
2-[bis(2-methylpropyl)alumanyloxy]-N,N-dimethylethanamine (PubChem CID 16716117) has the molecular formula C12H28AlNO
and a molecular weight of 229.34 g/mol. Its IUPAC name is 2-[bis(2-methylpropyl)alumanyloxy]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[bis(2-methylpropyl)alumanyloxy]-N,N-dimethylethanamine |
| PubChem CID | 16716117 |
| Molecular Formula | C12H28AlNO |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-[bis(2-methylpropyl)alumanyloxy]-N,N-dimethylethanamine |
| SMILES | CC(C)C[Al](CC(C)C)OCCN(C)C |
| InChI | InChI=1S/C4H10NO.2C4H9.Al/c1-5(2)3-4-6;2*1-4(2)3;/h3-4H2,1-2H3;2*4H,1H2,2-3H3;/q-1;;;+1 |
| InChIKey | MAYSPBQOJPGSMZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[bis(2-methylpropyl)alumanyloxy]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-methylpropyl)alumanyloxy]-N,N-dimethylethanamine?
The IUPAC name of 2-[bis(2-methylpropyl)alumanyloxy]-N,N-dimethylethanamine (CID 16716117) is 2-[bis(2-methylpropyl)alumanyloxy]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[bis(2-methylpropyl)alumanyloxy]-N,N-dimethylethanamine?
The canonical SMILES for 2-[bis(2-methylpropyl)alumanyloxy]-N,N-dimethylethanamine is CC(C)C[Al](CC(C)C)OCCN(C)C.
What is the InChIKey of 2-[bis(2-methylpropyl)alumanyloxy]-N,N-dimethylethanamine?
The InChIKey is MAYSPBQOJPGSMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10NO.2C4H9.Al/c1-5(2)3-4-6;2*1-4(2)3;/h3-4H2,1-2H3;2*4H,1H2,2-3H3;/q-1;;;+1.
What are the key properties of 2-[bis(2-methylpropyl)alumanyloxy]-N,N-dimethylethanamine?
2-[bis(2-methylpropyl)alumanyloxy]-N,N-dimethylethanamine has a molecular weight of 229.34 g/mol, XLogP of 2.87, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-methylpropyl)alumanyloxy]-N,N-dimethylethanamine is sourced from PubChem (CID 16716117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).