C21H23N5O5 — CID 167161233
(2S,3R,4R)-2-ethyl-3,4-dihydroxy-4-[2-[2-[4-(hydroxymethyl)phenyl]ethynyl]-6-(methylamino)purin-9-yl]butanoic acid (PubChem CID 167161233) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is (2S,3R,4R)-2-ethyl-3,4-dihydroxy-4-[2-[2-[4-(hydroxymethyl)phenyl]ethynyl]-6-(methylamino)purin-9-yl]butanoic acid.
| Compound Name | (2S,3R,4R)-2-ethyl-3,4-dihydroxy-4-[2-[2-[4-(hydroxymethyl)phenyl]ethynyl]-6-(methylamino)purin-9-yl]butanoic acid |
|---|---|
| PubChem CID | 167161233 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (2S,3R,4R)-2-ethyl-3,4-dihydroxy-4-[2-[2-[4-(hydroxymethyl)phenyl]ethynyl]-6-(methylamino)purin-9-yl]butanoic acid |
| SMILES | CC[C@H](C(=O)O)[C@@H](O)[C@@H](O)n1cnc2c(NC)nc(C#Cc3ccc(CO)cc3)nc21 |
| InChI | InChI=1S/C21H23N5O5/c1-3-14(21(30)31)17(28)20(29)26-11-23-16-18(22-2)24-15(25-19(16)26)9-8-12-4-6-13(10-27)7-5-12/h4-7,11,14,17,20,27-29H,3,10H2,1-2H3,(H,30,31)(H,22,24,25)/t14-,17+,20+/m0/s1 |
| InChIKey | RRRPJPRCUWQDRT-JNAXZKDPSA-N |
| XLogP | 0.72 |
| TPSA | 153.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|