C8H13F3N2 — CID 167162117
(3E)-5,5,5-trifluoro-1-N,1-N',3-trimethylpenta-1,3-diene-1,1-diamine (PubChem CID 167162117) has the molecular formula C8H13F3N2 and a molecular weight of 194.20 g/mol. Its IUPAC name is (3E)-5,5,5-trifluoro-1-N,1-N',3-trimethylpenta-1,3-diene-1,1-diamine.
| Compound Name | (3E)-5,5,5-trifluoro-1-N,1-N',3-trimethylpenta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 167162117 |
| Molecular Formula | C8H13F3N2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | (3E)-5,5,5-trifluoro-1-N,1-N',3-trimethylpenta-1,3-diene-1,1-diamine |
| SMILES | CNC(=C/C(C)=C/C(F)(F)F)NC |
| InChI | InChI=1S/C8H13F3N2/c1-6(5-8(9,10)11)4-7(12-2)13-3/h4-5,12-13H,1-3H3/b6-5+ |
| InChIKey | XOBWXDLUAIWBPR-AATRIKPKSA-N |
| XLogP | 1.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|