C23H20ClF6N5O — CID 167162267
3-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxyquinazolin-7-yl]-4,5-bis(trifluoromethyl)aniline (PubChem CID 167162267) has the molecular formula C23H20ClF6N5O and a molecular weight of 531.89 g/mol. Its IUPAC name is 3-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxyquinazolin-7-yl]-4,5-bis(trifluoromethyl)aniline.
| Compound Name | 3-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxyquinazolin-7-yl]-4,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 167162267 |
| Molecular Formula | C23H20ClF6N5O |
| Molecular Weight | 531.89 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 3-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxyquinazolin-7-yl]-4,5-bis(trifluoromethyl)aniline |
| SMILES | COc1nc(N2CC3CCC(C2)N3)c2cc(Cl)c(-c3cc(N)cc(C(F)(F)F)c3C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C23H20ClF6N5O/c1-36-21-33-18-7-13(14-4-10(31)5-16(22(25,26)27)19(14)23(28,29)30)17(24)6-15(18)20(34-21)35-8-11-2-3-12(9-35)32-11/h4-7,11-12,32H,2-3,8-9,31H2,1H3 |
| InChIKey | GDIFLGIGCMWPKM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.89 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|