C9H6F5NO2 — CID 167162361
2-amino-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid (PubChem CID 167162361) has the molecular formula C9H6F5NO2 and a molecular weight of 255.14 g/mol. Its IUPAC name is 2-amino-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid.
| Compound Name | 2-amino-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
|---|---|
| PubChem CID | 167162361 |
| Molecular Formula | C9H6F5NO2 |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-amino-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
| SMILES | Nc1cc(C(F)(F)C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C9H6F5NO2/c10-8(11,9(12,13)14)4-1-2-5(7(16)17)6(15)3-4/h1-3H,15H2,(H,16,17) |
| InChIKey | JAOXNURNPMXKFY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|