C14H18FNO — CID 167162444
(2E,4E,6E)-3-ethyl-7-formyl-N,4-dimethylnona-2,4,6,8-tetraenimidoyl fluoride (PubChem CID 167162444) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is (2E,4E,6E)-3-ethyl-7-formyl-N,4-dimethylnona-2,4,6,8-tetraenimidoyl fluoride.
| Compound Name | (2E,4E,6E)-3-ethyl-7-formyl-N,4-dimethylnona-2,4,6,8-tetraenimidoyl fluoride |
|---|---|
| PubChem CID | 167162444 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (2E,4E,6E)-3-ethyl-7-formyl-N,4-dimethylnona-2,4,6,8-tetraenimidoyl fluoride |
| SMILES | C=C/C(C=O)=C\C=C(C)\C(=C\C(F)=N\C)CC |
| InChI | InChI=1S/C14H18FNO/c1-5-12(10-17)8-7-11(3)13(6-2)9-14(15)16-4/h5,7-10H,1,6H2,2-4H3/b11-7+,12-8+,13-9+,16-14- |
| InChIKey | DOJSYNIYBMJFCS-PNHVINKKSA-N |
| XLogP | 3.58 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|