C21H26N8O2 — CID 167162922
N-[3-[3-[2-[(7-amino-6-cyano-3-ethyl-2-methylpyrazolo[1,5-a]pyrimidin-5-yl)amino]ethyl]-2-oxo-1-pyridinyl]propyl]formamide (PubChem CID 167162922) has the molecular formula C21H26N8O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[3-[3-[2-[(7-amino-6-cyano-3-ethyl-2-methylpyrazolo[1,5-a]pyrimidin-5-yl)amino]ethyl]-2-oxo-1-pyridinyl]propyl]formamide.
| Compound Name | N-[3-[3-[2-[(7-amino-6-cyano-3-ethyl-2-methylpyrazolo[1,5-a]pyrimidin-5-yl)amino]ethyl]-2-oxo-1-pyridinyl]propyl]formamide |
|---|---|
| PubChem CID | 167162922 |
| Molecular Formula | C21H26N8O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-[3-[3-[2-[(7-amino-6-cyano-3-ethyl-2-methylpyrazolo[1,5-a]pyrimidin-5-yl)amino]ethyl]-2-oxo-1-pyridinyl]propyl]formamide |
| SMILES | CCc1c(C)nn2c(N)c(C#N)c(NCCc3cccn(CCCNC=O)c3=O)nc12 |
| InChI | InChI=1S/C21H26N8O2/c1-3-16-14(2)27-29-18(23)17(12-22)19(26-20(16)29)25-9-7-15-6-4-10-28(21(15)31)11-5-8-24-13-30/h4,6,10,13H,3,5,7-9,11,23H2,1-2H3,(H,24,30)(H,25,26) |
| InChIKey | SIIWQNLISWAXJX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 143.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|