C24H45N — CID 167163039
(5E,9E)-5,9,12,12-tetramethyl-N-(2-methylbutan-2-yl)pentadeca-5,9-dien-2-imine (PubChem CID 167163039) has the molecular formula C24H45N and a molecular weight of 347.63 g/mol. Its IUPAC name is (5E,9E)-5,9,12,12-tetramethyl-N-(2-methylbutan-2-yl)pentadeca-5,9-dien-2-imine.
| Compound Name | (5E,9E)-5,9,12,12-tetramethyl-N-(2-methylbutan-2-yl)pentadeca-5,9-dien-2-imine |
|---|---|
| PubChem CID | 167163039 |
| Molecular Formula | C24H45N |
| Molecular Weight | 347.63 g/mol |
| Exact Mass | 347.36 |
| IUPAC Name | (5E,9E)-5,9,12,12-tetramethyl-N-(2-methylbutan-2-yl)pentadeca-5,9-dien-2-imine |
| SMILES | CCCC(C)(C)C/C=C(\C)CC/C=C(\C)CC/C(C)=N/C(C)(C)CC |
| InChI | InChI=1S/C24H45N/c1-10-18-23(6,7)19-17-21(4)14-12-13-20(3)15-16-22(5)25-24(8,9)11-2/h13,17H,10-12,14-16,18-19H2,1-9H3/b20-13+,21-17+,25-22+ |
| InChIKey | FSMIMRVONLMZHQ-OXRCWVBHSA-N |
| XLogP | 8.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.63 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|