C18H27ClN9O8PS — CID 167163260
[[(2S,3S,4R,5R)-5-[[2-chloro-6-(cyclopentylamino)-5-methylpyrimidin-4-yl]-(methylideneamino)amino]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl-(2H-tetrazol-5-yl)methyl]phosphonic acid (PubChem CID 167163260) has the molecular formula C18H27ClN9O8PS and a molecular weight of 595.96 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-[[2-chloro-6-(cyclopentylamino)-5-methylpyrimidin-4-yl]-(methylideneamino)amino]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl-(2H-tetrazol-5-yl)methyl]phosphonic acid.
| Compound Name | [[(2S,3S,4R,5R)-5-[[2-chloro-6-(cyclopentylamino)-5-methylpyrimidin-4-yl]-(methylideneamino)amino]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl-(2H-tetrazol-5-yl)methyl]phosphonic acid |
|---|---|
| PubChem CID | 167163260 |
| Molecular Formula | C18H27ClN9O8PS |
| Molecular Weight | 595.96 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-[[2-chloro-6-(cyclopentylamino)-5-methylpyrimidin-4-yl]-(methylideneamino)amino]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl-(2H-tetrazol-5-yl)methyl]phosphonic acid |
| SMILES | C=NN(c1nc(Cl)nc(NC2CCCC2)c1C)[C@@H]1O[C@H](CS(=O)(=O)C(c2nn[nH]n2)P(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H27ClN9O8PS/c1-8-13(21-9-5-3-4-6-9)22-18(19)23-15(8)28(20-2)16-12(30)11(29)10(36-16)7-38(34,35)17(37(31,32)33)14-24-26-27-25-14/h9-12,16-17,29-30H,2-7H2,1H3,(H,21,22,23)(H2,31,32,33)(H,24,25,26,27)/t10-,11-,12-,16-,17?/m1/s1 |
| InChIKey | UKXKWPANQQPKPM-JKGHAHRCSA-N |
| XLogP | -0.53 |
| TPSA | 249.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.96 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|