C29H36N6OS — CID 167163318
[[(3R)-1-(3,3-diaminohept-6-ynyl)pyrrolidin-3-yl]methylamino]-[2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]methanol (PubChem CID 167163318) has the molecular formula C29H36N6OS and a molecular weight of 516.72 g/mol. Its IUPAC name is [[(3R)-1-(3,3-diaminohept-6-ynyl)pyrrolidin-3-yl]methylamino]-[2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]methanol.
| Compound Name | [[(3R)-1-(3,3-diaminohept-6-ynyl)pyrrolidin-3-yl]methylamino]-[2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]methanol |
|---|---|
| PubChem CID | 167163318 |
| Molecular Formula | C29H36N6OS |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | [[(3R)-1-(3,3-diaminohept-6-ynyl)pyrrolidin-3-yl]methylamino]-[2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]methanol |
| SMILES | C#CCCC(N)(N)CCN1CC[C@H](CNC(O)c2ccc3c(c2)sc2nc(-c4ccc(C)cc4)cn23)C1 |
| InChI | InChI=1S/C29H36N6OS/c1-3-4-12-29(30,31)13-15-34-14-11-21(18-34)17-32-27(36)23-9-10-25-26(16-23)37-28-33-24(19-35(25)28)22-7-5-20(2)6-8-22/h1,5-10,16,19,21,27,32,36H,4,11-15,17-18,30-31H2,2H3/t21-,27?/m1/s1 |
| InChIKey | VDVBUCVFVCSNQY-XJQHNOHDSA-N |
| XLogP | 3.84 |
| TPSA | 104.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|