C26H31N5OS — CID 167163335
[3-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)propylamino]-[2-(3-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]methanol (PubChem CID 167163335) has the molecular formula C26H31N5OS and a molecular weight of 461.64 g/mol. Its IUPAC name is [3-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)propylamino]-[2-(3-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]methanol.
| Compound Name | [3-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)propylamino]-[2-(3-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]methanol |
|---|---|
| PubChem CID | 167163335 |
| Molecular Formula | C26H31N5OS |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | [3-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)propylamino]-[2-(3-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]methanol |
| SMILES | Cc1cccc(-c2cn3c(n2)sc2cc(C(O)NCCCN4CC5CC4CN5C)ccc23)c1 |
| InChI | InChI=1S/C26H31N5OS/c1-17-5-3-6-18(11-17)22-16-31-23-8-7-19(12-24(23)33-26(31)28-22)25(32)27-9-4-10-30-15-20-13-21(30)14-29(20)2/h3,5-8,11-12,16,20-21,25,27,32H,4,9-10,13-15H2,1-2H3 |
| InChIKey | FSNYWXLMTZSBTR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|