C31H29FN4O4S — CID 167163502
N-[(2E,4Z)-2-ethynylhexa-2,4-dienyl]sulfinyl-4-[4-[3-fluoro-4-(5-hydroxy-3-pyridinyl)benzoyl]piperazin-1-yl]benzamide (PubChem CID 167163502) has the molecular formula C31H29FN4O4S and a molecular weight of 572.66 g/mol. Its IUPAC name is N-[(2E,4Z)-2-ethynylhexa-2,4-dienyl]sulfinyl-4-[4-[3-fluoro-4-(5-hydroxy-3-pyridinyl)benzoyl]piperazin-1-yl]benzamide.
| Compound Name | N-[(2E,4Z)-2-ethynylhexa-2,4-dienyl]sulfinyl-4-[4-[3-fluoro-4-(5-hydroxy-3-pyridinyl)benzoyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 167163502 |
| Molecular Formula | C31H29FN4O4S |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | N-[(2E,4Z)-2-ethynylhexa-2,4-dienyl]sulfinyl-4-[4-[3-fluoro-4-(5-hydroxy-3-pyridinyl)benzoyl]piperazin-1-yl]benzamide |
| SMILES | C#C/C(=C\C=C/C)CS(=O)NC(=O)c1ccc(N2CCN(C(=O)c3ccc(-c4cncc(O)c4)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C31H29FN4O4S/c1-3-5-6-22(4-2)21-41(40)34-30(38)23-7-10-26(11-8-23)35-13-15-36(16-14-35)31(39)24-9-12-28(29(32)18-24)25-17-27(37)20-33-19-25/h2-3,5-12,17-20,37H,13-16,21H2,1H3,(H,34,38)/b5-3-,22-6+ |
| InChIKey | CXTOKTWGOIWSER-AFULJAOHSA-N |
| XLogP | 4.08 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|