About 4-methylsulfanyl-5-propan-2-yl-3,6-dihydro-2H-pyran
4-methylsulfanyl-5-propan-2-yl-3,6-dihydro-2H-pyran (PubChem CID 167163593) has the molecular formula C9H16OS
and a molecular weight of 172.29 g/mol. Its IUPAC name is 4-methylsulfanyl-5-propan-2-yl-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 4-methylsulfanyl-5-propan-2-yl-3,6-dihydro-2H-pyran |
| PubChem CID | 167163593 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 4-methylsulfanyl-5-propan-2-yl-3,6-dihydro-2H-pyran |
| SMILES | CSC1=C(C(C)C)COCC1 |
| InChI | InChI=1S/C9H16OS/c1-7(2)8-6-10-5-4-9(8)11-3/h7H,4-6H2,1-3H3 |
| InChIKey | CRPJPMZTZFPSQP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylsulfanyl-5-propan-2-yl-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanyl-5-propan-2-yl-3,6-dihydro-2H-pyran?
The IUPAC name of 4-methylsulfanyl-5-propan-2-yl-3,6-dihydro-2H-pyran (CID 167163593) is 4-methylsulfanyl-5-propan-2-yl-3,6-dihydro-2H-pyran.
What is the SMILES notation for 4-methylsulfanyl-5-propan-2-yl-3,6-dihydro-2H-pyran?
The canonical SMILES for 4-methylsulfanyl-5-propan-2-yl-3,6-dihydro-2H-pyran is CSC1=C(C(C)C)COCC1.
What is the InChIKey of 4-methylsulfanyl-5-propan-2-yl-3,6-dihydro-2H-pyran?
The InChIKey is CRPJPMZTZFPSQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16OS/c1-7(2)8-6-10-5-4-9(8)11-3/h7H,4-6H2,1-3H3.
What are the key properties of 4-methylsulfanyl-5-propan-2-yl-3,6-dihydro-2H-pyran?
4-methylsulfanyl-5-propan-2-yl-3,6-dihydro-2H-pyran has a molecular weight of 172.29 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-5-propan-2-yl-3,6-dihydro-2H-pyran is sourced from PubChem (CID 167163593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).