C16H30O — CID 167163788
4-[(1R,5S,6S)-1,2,2,5,6-pentamethyl-3-bicyclo[3.1.0]hexanyl]pentan-1-ol (PubChem CID 167163788) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is 4-[(1R,5S,6S)-1,2,2,5,6-pentamethyl-3-bicyclo[3.1.0]hexanyl]pentan-1-ol.
| Compound Name | 4-[(1R,5S,6S)-1,2,2,5,6-pentamethyl-3-bicyclo[3.1.0]hexanyl]pentan-1-ol |
|---|---|
| PubChem CID | 167163788 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 4-[(1R,5S,6S)-1,2,2,5,6-pentamethyl-3-bicyclo[3.1.0]hexanyl]pentan-1-ol |
| SMILES | CC(CCCO)C1C[C@@]2(C)[C@H](C)[C@]2(C)C1(C)C |
| InChI | InChI=1S/C16H30O/c1-11(8-7-9-17)13-10-15(5)12(2)16(15,6)14(13,3)4/h11-13,17H,7-10H2,1-6H3/t11?,12-,13?,15-,16+/m0/s1 |
| InChIKey | TVSXYWFPPBSOBO-SVJHHLCESA-N |
| XLogP | 4.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |