C27H40N2O5 — CID 167164140
2-[(Z)-5-(4,4-dimethyl-2-oxopentoxy)pent-1-enyl]-N,6-dimethyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide (PubChem CID 167164140) has the molecular formula C27H40N2O5 and a molecular weight of 472.63 g/mol. Its IUPAC name is 2-[(Z)-5-(4,4-dimethyl-2-oxopentoxy)pent-1-enyl]-N,6-dimethyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide.
| Compound Name | 2-[(Z)-5-(4,4-dimethyl-2-oxopentoxy)pent-1-enyl]-N,6-dimethyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 167164140 |
| Molecular Formula | C27H40N2O5 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | 2-[(Z)-5-(4,4-dimethyl-2-oxopentoxy)pent-1-enyl]-N,6-dimethyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide |
| SMILES | CNC(=O)C(CCC=O)N(C)C(=O)c1c(C)cccc1/C=C\CCCOCC(=O)CC(C)(C)C |
| InChI | InChI=1S/C27H40N2O5/c1-20-12-10-14-21(13-8-7-9-17-34-19-22(31)18-27(2,3)4)24(20)26(33)29(6)23(15-11-16-30)25(32)28-5/h8,10,12-14,16,23H,7,9,11,15,17-19H2,1-6H3,(H,28,32)/b13-8- |
| InChIKey | QJJORLPCJTZPMN-JYRVWZFOSA-N |
| XLogP | 3.98 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|