C21H27N3O6 — CID 167164151
tert-butyl 3-[[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]amino]propanoate (PubChem CID 167164151) has the molecular formula C21H27N3O6 and a molecular weight of 417.46 g/mol. Its IUPAC name is tert-butyl 3-[[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]amino]propanoate.
| Compound Name | tert-butyl 3-[[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 167164151 |
| Molecular Formula | C21H27N3O6 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | tert-butyl 3-[[2-[5-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-4-yl]amino]propanoate |
| SMILES | CNC(=O)CCC(C=O)N1C(=O)c2cccc(NCCC(=O)OC(C)(C)C)c2C1=O |
| InChI | InChI=1S/C21H27N3O6/c1-21(2,3)30-17(27)10-11-23-15-7-5-6-14-18(15)20(29)24(19(14)28)13(12-25)8-9-16(26)22-4/h5-7,12-13,23H,8-11H2,1-4H3,(H,22,26) |
| InChIKey | FJTIXKPKEQSULS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|