C7H11FO2 — CID 167164359
(3R,3aS,6S,6aR)-6-fluoro-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 167164359) has the molecular formula C7H11FO2 and a molecular weight of 146.16 g/mol. Its IUPAC name is (3R,3aS,6S,6aR)-6-fluoro-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3R,3aS,6S,6aR)-6-fluoro-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 167164359 |
| Molecular Formula | C7H11FO2 |
| Molecular Weight | 146.16 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | (3R,3aS,6S,6aR)-6-fluoro-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | C[C@@H]1CO[C@@H]2[C@H]1OC[C@@H]2F |
| InChI | InChI=1S/C7H11FO2/c1-4-2-9-7-5(8)3-10-6(4)7/h4-7H,2-3H2,1H3/t4-,5+,6+,7+/m1/s1 |
| InChIKey | GPKPLSNNCXUHMZ-BWBBJGPYSA-N |
| XLogP | 0.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.16 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |