C8H12F2O2 — CID 167164410
(3S,3aR,6aS)-3-ethyl-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan (PubChem CID 167164410) has the molecular formula C8H12F2O2 and a molecular weight of 178.18 g/mol. Its IUPAC name is (3S,3aR,6aS)-3-ethyl-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan.
| Compound Name | (3S,3aR,6aS)-3-ethyl-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan |
|---|---|
| PubChem CID | 167164410 |
| Molecular Formula | C8H12F2O2 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (3S,3aR,6aS)-3-ethyl-6,6-difluoro-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan |
| SMILES | CC[C@H]1CO[C@H]2[C@@H]1OCC2(F)F |
| InChI | InChI=1S/C8H12F2O2/c1-2-5-3-11-7-6(5)12-4-8(7,9)10/h5-7H,2-4H2,1H3/t5-,6+,7-/m0/s1 |
| InChIKey | USRWGPBRFPBTLX-XVMARJQXSA-N |
| XLogP | 1.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |