About (E)-5,5,6-trimethyl-3-methylideneoct-6-en-2-imine
(E)-5,5,6-trimethyl-3-methylideneoct-6-en-2-imine (PubChem CID 167164429) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is (E)-5,5,6-trimethyl-3-methylideneoct-6-en-2-imine.
Molecular Properties
| Compound Name | (E)-5,5,6-trimethyl-3-methylideneoct-6-en-2-imine |
| PubChem CID | 167164429 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (E)-5,5,6-trimethyl-3-methylideneoct-6-en-2-imine |
| SMILES | [H]/N=C(\C)C(=C)CC(C)(C)/C(C)=C/C |
| InChI | InChI=1S/C12H21N/c1-7-10(3)12(5,6)8-9(2)11(4)13/h7,13H,2,8H2,1,3-6H3/b10-7+,13-11+ |
| InChIKey | UUMMFUJOSYMNNG-CWOSXULZSA-N |
| XLogP | 3.96 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5,5,6-trimethyl-3-methylideneoct-6-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5,5,6-trimethyl-3-methylideneoct-6-en-2-imine?
The IUPAC name of (E)-5,5,6-trimethyl-3-methylideneoct-6-en-2-imine (CID 167164429) is (E)-5,5,6-trimethyl-3-methylideneoct-6-en-2-imine.
What is the SMILES notation for (E)-5,5,6-trimethyl-3-methylideneoct-6-en-2-imine?
The canonical SMILES for (E)-5,5,6-trimethyl-3-methylideneoct-6-en-2-imine is [H]/N=C(\C)C(=C)CC(C)(C)/C(C)=C/C.
What is the InChIKey of (E)-5,5,6-trimethyl-3-methylideneoct-6-en-2-imine?
The InChIKey is UUMMFUJOSYMNNG-CWOSXULZSA-N. The full InChI is InChI=1S/C12H21N/c1-7-10(3)12(5,6)8-9(2)11(4)13/h7,13H,2,8H2,1,3-6H3/b10-7+,13-11+.
What are the key properties of (E)-5,5,6-trimethyl-3-methylideneoct-6-en-2-imine?
(E)-5,5,6-trimethyl-3-methylideneoct-6-en-2-imine has a molecular weight of 179.31 g/mol, XLogP of 3.96, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5,5,6-trimethyl-3-methylideneoct-6-en-2-imine is sourced from PubChem (CID 167164429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).