C31H40O7S — CID 167164584
benzyl (2S)-2-[[(4aS,6S)-6-ethylsulfanyl-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]-3-cyclohexylpropanoate (PubChem CID 167164584) has the molecular formula C31H40O7S and a molecular weight of 556.72 g/mol. Its IUPAC name is benzyl (2S)-2-[[(4aS,6S)-6-ethylsulfanyl-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]-3-cyclohexylpropanoate.
| Compound Name | benzyl (2S)-2-[[(4aS,6S)-6-ethylsulfanyl-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]-3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 167164584 |
| Molecular Formula | C31H40O7S |
| Molecular Weight | 556.72 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | benzyl (2S)-2-[[(4aS,6S)-6-ethylsulfanyl-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]-3-cyclohexylpropanoate |
| SMILES | CCS[C@@H]1O[C@H]2COC(c3ccccc3)OC2C(O[C@@H](CC2CCCCC2)C(=O)OCc2ccccc2)C1O |
| InChI | InChI=1S/C31H40O7S/c1-2-39-31-26(32)28(27-25(37-31)20-35-30(38-27)23-16-10-5-11-17-23)36-24(18-21-12-6-3-7-13-21)29(33)34-19-22-14-8-4-9-15-22/h4-5,8-11,14-17,21,24-28,30-32H,2-3,6-7,12-13,18-20H2,1H3/t24-,25-,26?,27?,28?,30?,31-/m0/s1 |
| InChIKey | ZFSBDHQPPVFLDG-CQSRWORFSA-N |
| XLogP | 5.41 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.72 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |