About (5Z,6E)-6-ethylidene-4-phenyl-5-prop-2-enylidenefuro[2,3-d]pyrimidine
(5Z,6E)-6-ethylidene-4-phenyl-5-prop-2-enylidenefuro[2,3-d]pyrimidine (PubChem CID 167165100) has the molecular formula C17H14N2O
and a molecular weight of 262.31 g/mol. Its IUPAC name is (5Z,6E)-6-ethylidene-4-phenyl-5-prop-2-enylidenefuro[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | (5Z,6E)-6-ethylidene-4-phenyl-5-prop-2-enylidenefuro[2,3-d]pyrimidine |
| PubChem CID | 167165100 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (5Z,6E)-6-ethylidene-4-phenyl-5-prop-2-enylidenefuro[2,3-d]pyrimidine |
| SMILES | C=C/C=c1\c(=C/C)oc2ncnc(-c3ccccc3)c12 |
| InChI | InChI=1S/C17H14N2O/c1-3-8-13-14(4-2)20-17-15(13)16(18-11-19-17)12-9-6-5-7-10-12/h3-11H,1H2,2H3/b13-8+,14-4+ |
| InChIKey | AEHUXPDUPQMUKX-WVPIJKBQSA-N |
| XLogP | 2.66 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5Z,6E)-6-ethylidene-4-phenyl-5-prop-2-enylidenefuro[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,6E)-6-ethylidene-4-phenyl-5-prop-2-enylidenefuro[2,3-d]pyrimidine?
The IUPAC name of (5Z,6E)-6-ethylidene-4-phenyl-5-prop-2-enylidenefuro[2,3-d]pyrimidine (CID 167165100) is (5Z,6E)-6-ethylidene-4-phenyl-5-prop-2-enylidenefuro[2,3-d]pyrimidine.
What is the SMILES notation for (5Z,6E)-6-ethylidene-4-phenyl-5-prop-2-enylidenefuro[2,3-d]pyrimidine?
The canonical SMILES for (5Z,6E)-6-ethylidene-4-phenyl-5-prop-2-enylidenefuro[2,3-d]pyrimidine is C=C/C=c1\c(=C/C)oc2ncnc(-c3ccccc3)c12.
What is the InChIKey of (5Z,6E)-6-ethylidene-4-phenyl-5-prop-2-enylidenefuro[2,3-d]pyrimidine?
The InChIKey is AEHUXPDUPQMUKX-WVPIJKBQSA-N. The full InChI is InChI=1S/C17H14N2O/c1-3-8-13-14(4-2)20-17-15(13)16(18-11-19-17)12-9-6-5-7-10-12/h3-11H,1H2,2H3/b13-8+,14-4+.
What are the key properties of (5Z,6E)-6-ethylidene-4-phenyl-5-prop-2-enylidenefuro[2,3-d]pyrimidine?
(5Z,6E)-6-ethylidene-4-phenyl-5-prop-2-enylidenefuro[2,3-d]pyrimidine has a molecular weight of 262.31 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,6E)-6-ethylidene-4-phenyl-5-prop-2-enylidenefuro[2,3-d]pyrimidine is sourced from PubChem (CID 167165100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).