C8H14N2 — CID 167165495
(2R,6S)-4,10-diazatricyclo[5.2.1.02,6]decane (PubChem CID 167165495) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (2R,6S)-4,10-diazatricyclo[5.2.1.02,6]decane.
| Compound Name | (2R,6S)-4,10-diazatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 167165495 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (2R,6S)-4,10-diazatricyclo[5.2.1.02,6]decane |
| SMILES | C1CC2NC1[C@H]1CNC[C@@H]21 |
| InChI | InChI=1S/C8H14N2/c1-2-8-6-4-9-3-5(6)7(1)10-8/h5-10H,1-4H2/t5-,6+,7?,8? |
| InChIKey | SWSHTPYCZICGDC-XEDAXZNXSA-N |
| XLogP | -0.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |