C21H24F3N4OP — CID 167166014
6-dimethylphosphoryl-2-methyl-4-N-[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]quinazoline-4,7-diamine (PubChem CID 167166014) has the molecular formula C21H24F3N4OP and a molecular weight of 436.42 g/mol. Its IUPAC name is 6-dimethylphosphoryl-2-methyl-4-N-[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]quinazoline-4,7-diamine.
| Compound Name | 6-dimethylphosphoryl-2-methyl-4-N-[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]quinazoline-4,7-diamine |
|---|---|
| PubChem CID | 167166014 |
| Molecular Formula | C21H24F3N4OP |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 6-dimethylphosphoryl-2-methyl-4-N-[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]quinazoline-4,7-diamine |
| SMILES | Cc1nc(N[C@H](C)c2cccc(C(F)(F)F)c2C)c2cc(P(C)(C)=O)c(N)cc2n1 |
| InChI | InChI=1S/C21H24F3N4OP/c1-11-14(7-6-8-16(11)21(22,23)24)12(2)26-20-15-9-19(30(4,5)29)17(25)10-18(15)27-13(3)28-20/h6-10,12H,25H2,1-5H3,(H,26,27,28)/t12-/m1/s1 |
| InChIKey | BUWHBBVLVJVWHT-GFCCVEGCSA-N |
| XLogP | 5.27 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|