C24H24N8S — CID 167166261
4-N-(1H-indazol-6-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 167166261) has the molecular formula C24H24N8S and a molecular weight of 456.58 g/mol. Its IUPAC name is 4-N-(1H-indazol-6-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1H-indazol-6-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 167166261 |
| Molecular Formula | C24H24N8S |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 4-N-(1H-indazol-6-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CN1CCN(c2ccc(Nc3nc(Nc4ccc5cn[nH]c5c4)c4sccc4n3)cc2)CC1 |
| InChI | InChI=1S/C24H24N8S/c1-31-9-11-32(12-10-31)19-6-4-17(5-7-19)27-24-28-20-8-13-33-22(20)23(29-24)26-18-3-2-16-15-25-30-21(16)14-18/h2-8,13-15H,9-12H2,1H3,(H,25,30)(H2,26,27,28,29) |
| InChIKey | YRBQQEIOYAIHFP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|