C34H28Cl2FN3O7 — CID 167166530
[(1S,3R,4R,5R)-3,4-diacetyloxy-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-1-(4-chlorophenyl)-5-hydroxypentyl] 4-phenylbenzoate (PubChem CID 167166530) has the molecular formula C34H28Cl2FN3O7 and a molecular weight of 680.52 g/mol. Its IUPAC name is [(1S,3R,4R,5R)-3,4-diacetyloxy-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-1-(4-chlorophenyl)-5-hydroxypentyl] 4-phenylbenzoate.
| Compound Name | [(1S,3R,4R,5R)-3,4-diacetyloxy-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-1-(4-chlorophenyl)-5-hydroxypentyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 167166530 |
| Molecular Formula | C34H28Cl2FN3O7 |
| Molecular Weight | 680.52 g/mol |
| Exact Mass | 679.13 |
| IUPAC Name | [(1S,3R,4R,5R)-3,4-diacetyloxy-5-(4-chloro-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-1-(4-chlorophenyl)-5-hydroxypentyl] 4-phenylbenzoate |
| SMILES | CC(=O)O[C@@H]([C@@H](O)n1cc(F)c2c(Cl)ncnc21)[C@@H](C[C@H](OC(=O)c1ccc(-c2ccccc2)cc1)c1ccc(Cl)cc1)OC(C)=O |
| InChI | InChI=1S/C34H28Cl2FN3O7/c1-19(41)45-28(30(46-20(2)42)33(43)40-17-26(37)29-31(36)38-18-39-32(29)40)16-27(23-12-14-25(35)15-13-23)47-34(44)24-10-8-22(9-11-24)21-6-4-3-5-7-21/h3-15,17-18,27-28,30,33,43H,16H2,1-2H3/t27-,28+,30+,33+/m0/s1 |
| InChIKey | MSHMEAVQHIWGOT-HPLSSJBTSA-N |
| XLogP | 6.89 |
| TPSA | 129.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.52 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|