C23H31N5O — CID 167167090
4-[[(2S,4R)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-2-methylpiperidin-4-yl]amino]-N-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxamide (PubChem CID 167167090) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is 4-[[(2S,4R)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-2-methylpiperidin-4-yl]amino]-N-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxamide.
| Compound Name | 4-[[(2S,4R)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-2-methylpiperidin-4-yl]amino]-N-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 167167090 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 4-[[(2S,4R)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-2-methylpiperidin-4-yl]amino]-N-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
| SMILES | C=C/C=C\C(=C/C)CN1CC[C@@H](Nc2c(C(=O)NC)cnc3[nH]ccc23)C[C@@H]1C |
| InChI | InChI=1S/C23H31N5O/c1-5-7-8-17(6-2)15-28-12-10-18(13-16(28)3)27-21-19-9-11-25-22(19)26-14-20(21)23(29)24-4/h5-9,11,14,16,18H,1,10,12-13,15H2,2-4H3,(H,24,29)(H2,25,26,27)/b8-7-,17-6+/t16-,18+/m0/s1 |
| InChIKey | XPHZGXBUGYAOIF-ZDSIZYLYSA-N |
| XLogP | 3.88 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|