About (Z)-2,5-diiminohex-3-enamide
(Z)-2,5-diiminohex-3-enamide (PubChem CID 167167315) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is (Z)-2,5-diiminohex-3-enamide.
Molecular Properties
| Compound Name | (Z)-2,5-diiminohex-3-enamide |
| PubChem CID | 167167315 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | (Z)-2,5-diiminohex-3-enamide |
| SMILES | [H]/N=C(/C=C\C(C)=N\[H])C(N)=O |
| InChI | InChI=1S/C6H9N3O/c1-4(7)2-3-5(8)6(9)10/h2-3,7-8H,1H3,(H2,9,10)/b3-2-,7-4+,8-5- |
| InChIKey | CQNWEBRKBLMHAV-ZZCSMPLHSA-N |
| XLogP | 0.09 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,5-diiminohex-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,5-diiminohex-3-enamide?
The IUPAC name of (Z)-2,5-diiminohex-3-enamide (CID 167167315) is (Z)-2,5-diiminohex-3-enamide.
What is the SMILES notation for (Z)-2,5-diiminohex-3-enamide?
The canonical SMILES for (Z)-2,5-diiminohex-3-enamide is [H]/N=C(/C=C\C(C)=N\[H])C(N)=O.
What is the InChIKey of (Z)-2,5-diiminohex-3-enamide?
The InChIKey is CQNWEBRKBLMHAV-ZZCSMPLHSA-N. The full InChI is InChI=1S/C6H9N3O/c1-4(7)2-3-5(8)6(9)10/h2-3,7-8H,1H3,(H2,9,10)/b3-2-,7-4+,8-5-.
What are the key properties of (Z)-2,5-diiminohex-3-enamide?
(Z)-2,5-diiminohex-3-enamide has a molecular weight of 139.16 g/mol, XLogP of 0.09, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,5-diiminohex-3-enamide is sourced from PubChem (CID 167167315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).