C19H23BrO — CID 167167518
1-bromo-3-[(2E,4E)-5-cyclobutyl-2-prop-1-en-2-ylpenta-2,4-dienoxy]-5-methylbenzene (PubChem CID 167167518) has the molecular formula C19H23BrO and a molecular weight of 347.30 g/mol. Its IUPAC name is 1-bromo-3-[(2E,4E)-5-cyclobutyl-2-prop-1-en-2-ylpenta-2,4-dienoxy]-5-methylbenzene.
| Compound Name | 1-bromo-3-[(2E,4E)-5-cyclobutyl-2-prop-1-en-2-ylpenta-2,4-dienoxy]-5-methylbenzene |
|---|---|
| PubChem CID | 167167518 |
| Molecular Formula | C19H23BrO |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-bromo-3-[(2E,4E)-5-cyclobutyl-2-prop-1-en-2-ylpenta-2,4-dienoxy]-5-methylbenzene |
| SMILES | C=C(C)/C(=C\C=C\C1CCC1)COc1cc(C)cc(Br)c1 |
| InChI | InChI=1S/C19H23BrO/c1-14(2)17(9-5-8-16-6-4-7-16)13-21-19-11-15(3)10-18(20)12-19/h5,8-12,16H,1,4,6-7,13H2,2-3H3/b8-5+,17-9- |
| InChIKey | NDBDVCSJPDGPII-WIXUPIFPSA-N |
| XLogP | 6.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|