C27H31N3O2 — CID 167167795
4-[4-[1-[4-(3-ethoxyphenyl)phenyl]ethyl]piperazin-1-yl]benzamide (PubChem CID 167167795) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 4-[4-[1-[4-(3-ethoxyphenyl)phenyl]ethyl]piperazin-1-yl]benzamide.
| Compound Name | 4-[4-[1-[4-(3-ethoxyphenyl)phenyl]ethyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 167167795 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 4-[4-[1-[4-(3-ethoxyphenyl)phenyl]ethyl]piperazin-1-yl]benzamide |
| SMILES | CCOc1cccc(-c2ccc(C(C)N3CCN(c4ccc(C(N)=O)cc4)CC3)cc2)c1 |
| InChI | InChI=1S/C27H31N3O2/c1-3-32-26-6-4-5-24(19-26)22-9-7-21(8-10-22)20(2)29-15-17-30(18-16-29)25-13-11-23(12-14-25)27(28)31/h4-14,19-20H,3,15-18H2,1-2H3,(H2,28,31) |
| InChIKey | MAQYPLSGULVNQX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |