About N-(6-iminohexa-4,5-dienyl)butanamide
N-(6-iminohexa-4,5-dienyl)butanamide (PubChem CID 167168685) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is N-(6-iminohexa-4,5-dienyl)butanamide.
Molecular Properties
| Compound Name | N-(6-iminohexa-4,5-dienyl)butanamide |
| PubChem CID | 167168685 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-(6-iminohexa-4,5-dienyl)butanamide |
| SMILES | CCCC(=O)NCCCC=C=C=N |
| InChI | InChI=1S/C10H16N2O/c1-2-7-10(13)12-9-6-4-3-5-8-11/h3,11H,2,4,6-7,9H2,1H3,(H,12,13) |
| InChIKey | SVNXJIBMCQIOKB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(6-iminohexa-4,5-dienyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-iminohexa-4,5-dienyl)butanamide?
The IUPAC name of N-(6-iminohexa-4,5-dienyl)butanamide (CID 167168685) is N-(6-iminohexa-4,5-dienyl)butanamide.
What is the SMILES notation for N-(6-iminohexa-4,5-dienyl)butanamide?
The canonical SMILES for N-(6-iminohexa-4,5-dienyl)butanamide is CCCC(=O)NCCCC=C=C=N.
What is the InChIKey of N-(6-iminohexa-4,5-dienyl)butanamide?
The InChIKey is SVNXJIBMCQIOKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-2-7-10(13)12-9-6-4-3-5-8-11/h3,11H,2,4,6-7,9H2,1H3,(H,12,13).
What are the key properties of N-(6-iminohexa-4,5-dienyl)butanamide?
N-(6-iminohexa-4,5-dienyl)butanamide has a molecular weight of 180.25 g/mol, XLogP of 1.64, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-iminohexa-4,5-dienyl)butanamide is sourced from PubChem (CID 167168685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).