C13H13N6O3S- — CID 167168858
2-[4-[[3-(sulfinatoamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3,4-oxadiazole (PubChem CID 167168858) has the molecular formula C13H13N6O3S- and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-[4-[[3-(sulfinatoamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3,4-oxadiazole.
| Compound Name | 2-[4-[[3-(sulfinatoamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 167168858 |
| Molecular Formula | C13H13N6O3S- |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-[4-[[3-(sulfinatoamino)cyclobutyl]amino]-1H-pyrrolo[2,3-b]pyridin-5-yl]-1,3,4-oxadiazole |
| SMILES | O=S([O-])NC1CC(Nc2c(-c3nnco3)cnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C13H14N6O3S/c20-23(21)19-8-3-7(4-8)17-11-9-1-2-14-12(9)15-5-10(11)13-18-16-6-22-13/h1-2,5-8,19H,3-4H2,(H,20,21)(H2,14,15,17)/p-1 |
| InChIKey | NFRZLPDXGPMEKB-UHFFFAOYSA-M |
| XLogP | 0.94 |
| TPSA | 131.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|