C12H11N3O2S — CID 167169074
(5Z)-4-hydroxy-3-methyl-5-(1H-pyrrolo[2,3-c]pyridin-3-ylmethylidene)-1,3-thiazolidin-2-one (PubChem CID 167169074) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is (5Z)-4-hydroxy-3-methyl-5-(1H-pyrrolo[2,3-c]pyridin-3-ylmethylidene)-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-4-hydroxy-3-methyl-5-(1H-pyrrolo[2,3-c]pyridin-3-ylmethylidene)-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 167169074 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (5Z)-4-hydroxy-3-methyl-5-(1H-pyrrolo[2,3-c]pyridin-3-ylmethylidene)-1,3-thiazolidin-2-one |
| SMILES | CN1C(=O)S/C(=C\c2c[nH]c3cnccc23)C1O |
| InChI | InChI=1S/C12H11N3O2S/c1-15-11(16)10(18-12(15)17)4-7-5-14-9-6-13-3-2-8(7)9/h2-6,11,14,16H,1H3/b10-4- |
| InChIKey | XTSBKCNHZCCXOW-WMZJFQQLSA-N |
| XLogP | 2.02 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|