C15H10BrF3N2O — CID 167169475
(8-bromo-2-methylimidazo[1,2-a]pyridin-3-yl)-(3,4,5-trifluorophenyl)methanol (PubChem CID 167169475) has the molecular formula C15H10BrF3N2O and a molecular weight of 371.16 g/mol. Its IUPAC name is (8-bromo-2-methylimidazo[1,2-a]pyridin-3-yl)-(3,4,5-trifluorophenyl)methanol.
| Compound Name | (8-bromo-2-methylimidazo[1,2-a]pyridin-3-yl)-(3,4,5-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 167169475 |
| Molecular Formula | C15H10BrF3N2O |
| Molecular Weight | 371.16 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | (8-bromo-2-methylimidazo[1,2-a]pyridin-3-yl)-(3,4,5-trifluorophenyl)methanol |
| SMILES | Cc1nc2c(Br)cccn2c1C(O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H10BrF3N2O/c1-7-13(21-4-2-3-9(16)15(21)20-7)14(22)8-5-10(17)12(19)11(18)6-8/h2-6,14,22H,1H3 |
| InChIKey | RRPKKXHORILFKU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.16 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|