C16H11BrF3N3O — CID 167169507
8-bromo-2-ethyl-3-[nitroso-(3,4,5-trifluorophenyl)methyl]imidazo[1,2-a]pyridine (PubChem CID 167169507) has the molecular formula C16H11BrF3N3O and a molecular weight of 398.18 g/mol. Its IUPAC name is 8-bromo-2-ethyl-3-[nitroso-(3,4,5-trifluorophenyl)methyl]imidazo[1,2-a]pyridine.
| Compound Name | 8-bromo-2-ethyl-3-[nitroso-(3,4,5-trifluorophenyl)methyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 167169507 |
| Molecular Formula | C16H11BrF3N3O |
| Molecular Weight | 398.18 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | 8-bromo-2-ethyl-3-[nitroso-(3,4,5-trifluorophenyl)methyl]imidazo[1,2-a]pyridine |
| SMILES | CCc1nc2c(Br)cccn2c1C(N=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C16H11BrF3N3O/c1-2-12-15(23-5-3-4-9(17)16(23)21-12)14(22-24)8-6-10(18)13(20)11(19)7-8/h3-7,14H,2H2,1H3 |
| InChIKey | RBQOQAIETLFLNJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.18 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|