About (3Z,5Z)-4,8-dimethyl-2-methylidene-7H-1-benzoxonine
(3Z,5Z)-4,8-dimethyl-2-methylidene-7H-1-benzoxonine (PubChem CID 167169788) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is (3Z,5Z)-4,8-dimethyl-2-methylidene-7H-1-benzoxonine.
Molecular Properties
| Compound Name | (3Z,5Z)-4,8-dimethyl-2-methylidene-7H-1-benzoxonine |
| PubChem CID | 167169788 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (3Z,5Z)-4,8-dimethyl-2-methylidene-7H-1-benzoxonine |
| SMILES | C=C1/C=C(C)\C=C/Cc2c(C)cccc2O1 |
| InChI | InChI=1S/C15H16O/c1-11-6-4-8-14-12(2)7-5-9-15(14)16-13(3)10-11/h4-7,9-10H,3,8H2,1-2H3/b6-4-,11-10- |
| InChIKey | QURFYCBHQGZSBK-RCORZRHRSA-N |
| XLogP | 3.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3Z,5Z)-4,8-dimethyl-2-methylidene-7H-1-benzoxonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-4,8-dimethyl-2-methylidene-7H-1-benzoxonine?
The IUPAC name of (3Z,5Z)-4,8-dimethyl-2-methylidene-7H-1-benzoxonine (CID 167169788) is (3Z,5Z)-4,8-dimethyl-2-methylidene-7H-1-benzoxonine.
What is the SMILES notation for (3Z,5Z)-4,8-dimethyl-2-methylidene-7H-1-benzoxonine?
The canonical SMILES for (3Z,5Z)-4,8-dimethyl-2-methylidene-7H-1-benzoxonine is C=C1/C=C(C)\C=C/Cc2c(C)cccc2O1.
What is the InChIKey of (3Z,5Z)-4,8-dimethyl-2-methylidene-7H-1-benzoxonine?
The InChIKey is QURFYCBHQGZSBK-RCORZRHRSA-N. The full InChI is InChI=1S/C15H16O/c1-11-6-4-8-14-12(2)7-5-9-15(14)16-13(3)10-11/h4-7,9-10H,3,8H2,1-2H3/b6-4-,11-10-.
What are the key properties of (3Z,5Z)-4,8-dimethyl-2-methylidene-7H-1-benzoxonine?
(3Z,5Z)-4,8-dimethyl-2-methylidene-7H-1-benzoxonine has a molecular weight of 212.29 g/mol, XLogP of 3.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-4,8-dimethyl-2-methylidene-7H-1-benzoxonine is sourced from PubChem (CID 167169788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).