C9H12F3NO4 — CID 167170354
2-methyl-3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid (PubChem CID 167170354) has the molecular formula C9H12F3NO4 and a molecular weight of 255.19 g/mol. Its IUPAC name is 2-methyl-3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid.
| Compound Name | 2-methyl-3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 167170354 |
| Molecular Formula | C9H12F3NO4 |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-methyl-3-prop-2-enoxy-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
| SMILES | C=CCOCC(C)(NC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H12F3NO4/c1-3-4-17-5-8(2,7(15)16)13-6(14)9(10,11)12/h3H,1,4-5H2,2H3,(H,13,14)(H,15,16) |
| InChIKey | LQHWRMZBXZQNRL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|