C10H21N2O4+ — CID 167170567
[3-carboxy-2-(ethoxycarbonylamino)propyl]-trimethylazanium (PubChem CID 167170567) has the molecular formula C10H21N2O4+ and a molecular weight of 233.29 g/mol. Its IUPAC name is [3-carboxy-2-(ethoxycarbonylamino)propyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-(ethoxycarbonylamino)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 167170567 |
| Molecular Formula | C10H21N2O4+ |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | [3-carboxy-2-(ethoxycarbonylamino)propyl]-trimethylazanium |
| SMILES | CCOC(=O)NC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C10H20N2O4/c1-5-16-10(15)11-8(6-9(13)14)7-12(2,3)4/h8H,5-7H2,1-4H3,(H-,11,13,14,15)/p+1 |
| InChIKey | ITBOHSPVDPPVSR-UHFFFAOYSA-O |
| XLogP | 0.28 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|