C17H21F3N4O3 — CID 167171105
(8R,8aS)-2-[3-cyclopropyloxy-6-nitro-2-(trifluoromethyl)phenyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-8-amine (PubChem CID 167171105) has the molecular formula C17H21F3N4O3 and a molecular weight of 386.37 g/mol. Its IUPAC name is (8R,8aS)-2-[3-cyclopropyloxy-6-nitro-2-(trifluoromethyl)phenyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-8-amine.
| Compound Name | (8R,8aS)-2-[3-cyclopropyloxy-6-nitro-2-(trifluoromethyl)phenyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 167171105 |
| Molecular Formula | C17H21F3N4O3 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (8R,8aS)-2-[3-cyclopropyloxy-6-nitro-2-(trifluoromethyl)phenyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-8-amine |
| SMILES | N[C@@H]1CCN2CCN(c3c([N+](=O)[O-])ccc(OC4CC4)c3C(F)(F)F)C[C@@H]12 |
| InChI | InChI=1S/C17H21F3N4O3/c18-17(19,20)15-14(27-10-1-2-10)4-3-12(24(25)26)16(15)23-8-7-22-6-5-11(21)13(22)9-23/h3-4,10-11,13H,1-2,5-9,21H2/t11-,13+/m1/s1 |
| InChIKey | GACVJKCDLITHRM-YPMHNXCESA-N |
| XLogP | 2.38 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|