C20H30N2O2 — CID 167171418
6-methoxy-1-(2-methyldecyl)-1,5-naphthyridin-2-one (PubChem CID 167171418) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 6-methoxy-1-(2-methyldecyl)-1,5-naphthyridin-2-one.
| Compound Name | 6-methoxy-1-(2-methyldecyl)-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 167171418 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 6-methoxy-1-(2-methyldecyl)-1,5-naphthyridin-2-one |
| SMILES | CCCCCCCCC(C)Cn1c(=O)ccc2nc(OC)ccc21 |
| InChI | InChI=1S/C20H30N2O2/c1-4-5-6-7-8-9-10-16(2)15-22-18-12-13-19(24-3)21-17(18)11-14-20(22)23/h11-14,16H,4-10,15H2,1-3H3 |
| InChIKey | KBBQKXDRCZYTQK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|