C47H55ClN2O2 — CID 167171523
3-N-(4-tert-butyl-2,6-dimethylphenyl)-1-N,1-N-bis(4-tert-butylphenyl)-2-chloro-3-N-(2,3-dihydro-1,4-benzodioxin-5-yl)-5-methylbenzene-1,3-diamine (PubChem CID 167171523) has the molecular formula C47H55ClN2O2 and a molecular weight of 715.42 g/mol. Its IUPAC name is 3-N-(4-tert-butyl-2,6-dimethylphenyl)-1-N,1-N-bis(4-tert-butylphenyl)-2-chloro-3-N-(2,3-dihydro-1,4-benzodioxin-5-yl)-5-methylbenzene-1,3-diamine.
| Compound Name | 3-N-(4-tert-butyl-2,6-dimethylphenyl)-1-N,1-N-bis(4-tert-butylphenyl)-2-chloro-3-N-(2,3-dihydro-1,4-benzodioxin-5-yl)-5-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 167171523 |
| Molecular Formula | C47H55ClN2O2 |
| Molecular Weight | 715.42 g/mol |
| Exact Mass | 714.40 |
| IUPAC Name | 3-N-(4-tert-butyl-2,6-dimethylphenyl)-1-N,1-N-bis(4-tert-butylphenyl)-2-chloro-3-N-(2,3-dihydro-1,4-benzodioxin-5-yl)-5-methylbenzene-1,3-diamine |
| SMILES | Cc1cc(N(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)c(Cl)c(N(c2cccc3c2OCCO3)c2c(C)cc(C(C)(C)C)cc2C)c1 |
| InChI | InChI=1S/C47H55ClN2O2/c1-30-26-39(49(36-20-16-33(17-21-36)45(4,5)6)37-22-18-34(19-23-37)46(7,8)9)42(48)40(27-30)50(38-14-13-15-41-44(38)52-25-24-51-41)43-31(2)28-35(29-32(43)3)47(10,11)12/h13-23,26-29H,24-25H2,1-12H3 |
| InChIKey | KSXHVOJHNABQOC-UHFFFAOYSA-N |
| XLogP | 13.87 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.42 |
| LogP ≤ 5 | 13.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |