About 4,4-difluoro-N'-methyl-N-prop-2-enylidenepentanimidamide
4,4-difluoro-N'-methyl-N-prop-2-enylidenepentanimidamide (PubChem CID 167172059) has the molecular formula C9H14F2N2
and a molecular weight of 188.22 g/mol. Its IUPAC name is 4,4-difluoro-N'-methyl-N-prop-2-enylidenepentanimidamide.
Molecular Properties
| Compound Name | 4,4-difluoro-N'-methyl-N-prop-2-enylidenepentanimidamide |
| PubChem CID | 167172059 |
| Molecular Formula | C9H14F2N2 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 4,4-difluoro-N'-methyl-N-prop-2-enylidenepentanimidamide |
| SMILES | C=C/C=N/C(CCC(C)(F)F)=N\C |
| InChI | InChI=1S/C9H14F2N2/c1-4-7-13-8(12-3)5-6-9(2,10)11/h4,7H,1,5-6H2,2-3H3/b12-8-,13-7+ |
| InChIKey | JCCSVBCXDJHCLK-CZAVNJROSA-N |
| XLogP | 2.71 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluoro-N'-methyl-N-prop-2-enylidenepentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-N'-methyl-N-prop-2-enylidenepentanimidamide?
The IUPAC name of 4,4-difluoro-N'-methyl-N-prop-2-enylidenepentanimidamide (CID 167172059) is 4,4-difluoro-N'-methyl-N-prop-2-enylidenepentanimidamide.
What is the SMILES notation for 4,4-difluoro-N'-methyl-N-prop-2-enylidenepentanimidamide?
The canonical SMILES for 4,4-difluoro-N'-methyl-N-prop-2-enylidenepentanimidamide is C=C/C=N/C(CCC(C)(F)F)=N\C.
What is the InChIKey of 4,4-difluoro-N'-methyl-N-prop-2-enylidenepentanimidamide?
The InChIKey is JCCSVBCXDJHCLK-CZAVNJROSA-N. The full InChI is InChI=1S/C9H14F2N2/c1-4-7-13-8(12-3)5-6-9(2,10)11/h4,7H,1,5-6H2,2-3H3/b12-8-,13-7+.
What are the key properties of 4,4-difluoro-N'-methyl-N-prop-2-enylidenepentanimidamide?
4,4-difluoro-N'-methyl-N-prop-2-enylidenepentanimidamide has a molecular weight of 188.22 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-N'-methyl-N-prop-2-enylidenepentanimidamide is sourced from PubChem (CID 167172059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).