C10H14F4N2 — CID 167172070
(2Z)-5,6,6,6-tetrafluoro-N,5-dimethyl-2-[(methylideneamino)methylidene]hexan-1-imine (PubChem CID 167172070) has the molecular formula C10H14F4N2 and a molecular weight of 238.23 g/mol. Its IUPAC name is (2Z)-5,6,6,6-tetrafluoro-N,5-dimethyl-2-[(methylideneamino)methylidene]hexan-1-imine.
| Compound Name | (2Z)-5,6,6,6-tetrafluoro-N,5-dimethyl-2-[(methylideneamino)methylidene]hexan-1-imine |
|---|---|
| PubChem CID | 167172070 |
| Molecular Formula | C10H14F4N2 |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (2Z)-5,6,6,6-tetrafluoro-N,5-dimethyl-2-[(methylideneamino)methylidene]hexan-1-imine |
| SMILES | C=N/C=C(\C=N\C)CCC(C)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F4N2/c1-9(11,10(12,13)14)5-4-8(6-15-2)7-16-3/h6-7H,2,4-5H2,1,3H3/b8-6-,16-7+ |
| InChIKey | ZFXIZIFARXGUDJ-JVTGKPJRSA-N |
| XLogP | 3.34 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|