C10H11F5N2 — CID 167172118
1-methyl-2-methylidene-4-(3,3,4,4,4-pentafluorobutyl)pyrimidine (PubChem CID 167172118) has the molecular formula C10H11F5N2 and a molecular weight of 254.20 g/mol. Its IUPAC name is 1-methyl-2-methylidene-4-(3,3,4,4,4-pentafluorobutyl)pyrimidine.
| Compound Name | 1-methyl-2-methylidene-4-(3,3,4,4,4-pentafluorobutyl)pyrimidine |
|---|---|
| PubChem CID | 167172118 |
| Molecular Formula | C10H11F5N2 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 1-methyl-2-methylidene-4-(3,3,4,4,4-pentafluorobutyl)pyrimidine |
| SMILES | C=C1N=C(CCC(F)(F)C(F)(F)F)C=CN1C |
| InChI | InChI=1S/C10H11F5N2/c1-7-16-8(4-6-17(7)2)3-5-9(11,12)10(13,14)15/h4,6H,1,3,5H2,2H3 |
| InChIKey | OKHIPGXNDBPRKT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|