About 5-fluoro-2-methyl-2,3-dihydro-1H-pyrrole
5-fluoro-2-methyl-2,3-dihydro-1H-pyrrole (PubChem CID 167172418) has the molecular formula C5H8FN
and a molecular weight of 101.12 g/mol. Its IUPAC name is 5-fluoro-2-methyl-2,3-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 5-fluoro-2-methyl-2,3-dihydro-1H-pyrrole |
| PubChem CID | 167172418 |
| Molecular Formula | C5H8FN |
| Molecular Weight | 101.12 g/mol |
| Exact Mass | 101.06 |
| IUPAC Name | 5-fluoro-2-methyl-2,3-dihydro-1H-pyrrole |
| SMILES | CC1CC=C(F)N1 |
| InChI | InChI=1S/C5H8FN/c1-4-2-3-5(6)7-4/h3-4,7H,2H2,1H3 |
| InChIKey | DHQZUBTXLVRDTQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.12 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-methyl-2,3-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-methyl-2,3-dihydro-1H-pyrrole?
The IUPAC name of 5-fluoro-2-methyl-2,3-dihydro-1H-pyrrole (CID 167172418) is 5-fluoro-2-methyl-2,3-dihydro-1H-pyrrole.
What is the SMILES notation for 5-fluoro-2-methyl-2,3-dihydro-1H-pyrrole?
The canonical SMILES for 5-fluoro-2-methyl-2,3-dihydro-1H-pyrrole is CC1CC=C(F)N1.
What is the InChIKey of 5-fluoro-2-methyl-2,3-dihydro-1H-pyrrole?
The InChIKey is DHQZUBTXLVRDTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FN/c1-4-2-3-5(6)7-4/h3-4,7H,2H2,1H3.
What are the key properties of 5-fluoro-2-methyl-2,3-dihydro-1H-pyrrole?
5-fluoro-2-methyl-2,3-dihydro-1H-pyrrole has a molecular weight of 101.12 g/mol, XLogP of 1.18, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-methyl-2,3-dihydro-1H-pyrrole is sourced from PubChem (CID 167172418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).