C13H18N4O — CID 167172659
5-methoxy-11-propan-2-yl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene (PubChem CID 167172659) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 5-methoxy-11-propan-2-yl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene.
| Compound Name | 5-methoxy-11-propan-2-yl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
|---|---|
| PubChem CID | 167172659 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 5-methoxy-11-propan-2-yl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
| SMILES | COc1cnc2c(c1)nc1n2CCN(C(C)C)C1 |
| InChI | InChI=1S/C13H18N4O/c1-9(2)16-4-5-17-12(8-16)15-11-6-10(18-3)7-14-13(11)17/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | FRPRDXNGYHKSFW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |