C15H21ClN4O — CID 167172666
(10S)-5-chloro-8-ethyl-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one (PubChem CID 167172666) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is (10S)-5-chloro-8-ethyl-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one.
| Compound Name | (10S)-5-chloro-8-ethyl-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one |
|---|---|
| PubChem CID | 167172666 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (10S)-5-chloro-8-ethyl-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-9-one |
| SMILES | CCN1C(=O)[C@@H]2CN(C(C)C)CCN2c2ncc(Cl)cc21 |
| InChI | InChI=1S/C15H21ClN4O/c1-4-19-12-7-11(16)8-17-14(12)20-6-5-18(10(2)3)9-13(20)15(19)21/h7-8,10,13H,4-6,9H2,1-3H3/t13-/m0/s1 |
| InChIKey | CSULZUWGGNASMT-ZDUSSCGKSA-N |
| XLogP | 2.00 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |