C15H22N6 — CID 167173116
11-ethyl-5-piperazin-1-yl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene (PubChem CID 167173116) has the molecular formula C15H22N6 and a molecular weight of 286.38 g/mol. Its IUPAC name is 11-ethyl-5-piperazin-1-yl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene.
| Compound Name | 11-ethyl-5-piperazin-1-yl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
|---|---|
| PubChem CID | 167173116 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 11-ethyl-5-piperazin-1-yl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
| SMILES | CCN1CCn2c(nc3cc(N4CCNCC4)cnc32)C1 |
| InChI | InChI=1S/C15H22N6/c1-2-19-7-8-21-14(11-19)18-13-9-12(10-17-15(13)21)20-5-3-16-4-6-20/h9-10,16H,2-8,11H2,1H3 |
| InChIKey | XUQJZPWBABWTEV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |