C17H24N4 — CID 167173126
5-(azetidin-1-yl)-8-methyl-11-propan-2-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene (PubChem CID 167173126) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 5-(azetidin-1-yl)-8-methyl-11-propan-2-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene.
| Compound Name | 5-(azetidin-1-yl)-8-methyl-11-propan-2-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
|---|---|
| PubChem CID | 167173126 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 5-(azetidin-1-yl)-8-methyl-11-propan-2-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
| SMILES | Cc1c2n(c3ncc(N4CCC4)cc13)CCN(C(C)C)C2 |
| InChI | InChI=1S/C17H24N4/c1-12(2)20-7-8-21-16(11-20)13(3)15-9-14(10-18-17(15)21)19-5-4-6-19/h9-10,12H,4-8,11H2,1-3H3 |
| InChIKey | KXOWSYMGBAGISI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |