C15H19N3O — CID 167173153
1-(11-propan-2-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-5-yl)ethanone (PubChem CID 167173153) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 1-(11-propan-2-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-5-yl)ethanone.
| Compound Name | 1-(11-propan-2-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-5-yl)ethanone |
|---|---|
| PubChem CID | 167173153 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 1-(11-propan-2-yl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-5-yl)ethanone |
| SMILES | CC(=O)c1cnc2c(c1)cc1n2CCN(C(C)C)C1 |
| InChI | InChI=1S/C15H19N3O/c1-10(2)17-4-5-18-14(9-17)7-12-6-13(11(3)19)8-16-15(12)18/h6-8,10H,4-5,9H2,1-3H3 |
| InChIKey | KOAXMTXXIXHSHO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |